C20H21FN2O4 — CID 142847335
N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-3-fluorobenzamide (PubChem CID 142847335) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-3-fluorobenzamide.
| Compound Name | N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 142847335 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(Z)-1-(4-ethoxyphenyl)-3-(2-hydroxyethylamino)-3-oxoprop-1-en-2-yl]-3-fluorobenzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2cccc(F)c2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C20H21FN2O4/c1-2-27-17-8-6-14(7-9-17)12-18(20(26)22-10-11-24)23-19(25)15-4-3-5-16(21)13-15/h3-9,12-13,24H,2,10-11H2,1H3,(H,22,26)(H,23,25)/b18-12- |
| InChIKey | IUCNFIOCRPHIKN-PDGQHHTCSA-N |
| XLogP | 2.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|