C20H24N2O3 — CID 142847951
[(2S)-2-(hydroxymethyl)-4-iminopyrrolidin-1-yl]-[4-(2-methylphenyl)phenyl]methanone;methanol (PubChem CID 142847951) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(2S)-2-(hydroxymethyl)-4-iminopyrrolidin-1-yl]-[4-(2-methylphenyl)phenyl]methanone;methanol.
| Compound Name | [(2S)-2-(hydroxymethyl)-4-iminopyrrolidin-1-yl]-[4-(2-methylphenyl)phenyl]methanone;methanol |
|---|---|
| PubChem CID | 142847951 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(2S)-2-(hydroxymethyl)-4-iminopyrrolidin-1-yl]-[4-(2-methylphenyl)phenyl]methanone;methanol |
| SMILES | CO.[H]/N=C1\C[C@@H](CO)N(C(=O)c2ccc(-c3ccccc3C)cc2)C1 |
| InChI | InChI=1S/C19H20N2O2.CH4O/c1-13-4-2-3-5-18(13)14-6-8-15(9-7-14)19(23)21-11-16(20)10-17(21)12-22;1-2/h2-9,17,20,22H,10-12H2,1H3;2H,1H3/b20-16+;/t17-;/m0./s1 |
| InChIKey | KHJUHOWIZPFLSU-YSGFADEQSA-N |
| XLogP | 2.50 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|