C20H20N2O2 — CID 142170197
(2S)-4-imino-1-[5-(2-methylphenyl)bicyclo[4.1.0]hepta-2,4-diene-2-carbonyl]pyrrolidine-2-carbaldehyde (PubChem CID 142170197) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2S)-4-imino-1-[5-(2-methylphenyl)bicyclo[4.1.0]hepta-2,4-diene-2-carbonyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-4-imino-1-[5-(2-methylphenyl)bicyclo[4.1.0]hepta-2,4-diene-2-carbonyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 142170197 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S)-4-imino-1-[5-(2-methylphenyl)bicyclo[4.1.0]hepta-2,4-diene-2-carbonyl]pyrrolidine-2-carbaldehyde |
| SMILES | [H]/N=C1\C[C@@H](C=O)N(C(=O)C2=CC=C(c3ccccc3C)C3CC23)C1 |
| InChI | InChI=1S/C20H20N2O2/c1-12-4-2-3-5-15(12)16-6-7-17(19-9-18(16)19)20(24)22-10-13(21)8-14(22)11-23/h2-7,11,14,18-19,21H,8-10H2,1H3/b21-13+/t14-,18?,19?/m0/s1 |
| InChIKey | SBLZHBNVJROGDW-MOJIOTPSSA-N |
| XLogP | 2.77 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|