C26H21N3O3 — CID 89152466
2-[[4-imino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 89152466) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[[4-imino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-imino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89152466 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[[4-imino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | [H]/N=C1\CC(CN2C(=O)c3ccccc3C2=O)N(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C26H21N3O3/c27-20-14-21(16-29-25(31)22-8-4-5-9-23(22)26(29)32)28(15-20)24(30)19-12-10-18(11-13-19)17-6-2-1-3-7-17/h1-13,21,27H,14-16H2/b27-20+ |
| InChIKey | NFFIHSJRCQXRPG-NHFJDJAPSA-N |
| XLogP | 3.88 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|