C11H14N2O — CID 142848853
1-(3-methylphenoxy)butane-2,3-diimine (PubChem CID 142848853) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(3-methylphenoxy)butane-2,3-diimine.
| Compound Name | 1-(3-methylphenoxy)butane-2,3-diimine |
|---|---|
| PubChem CID | 142848853 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(3-methylphenoxy)butane-2,3-diimine |
| SMILES | [H]/N=C(C)/C(COc1cccc(C)c1)=N\[H] |
| InChI | InChI=1S/C11H14N2O/c1-8-4-3-5-10(6-8)14-7-11(13)9(2)12/h3-6,12-13H,7H2,1-2H3/b12-9+,13-11- |
| InChIKey | CXVPCIKEMWPHOX-NYGJOUKGSA-N |
| XLogP | 2.43 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|