C59H70O6P2 — CID 142850693
bis(5-methyl-2-propan-2-ylphenol);(5-methyl-2-propan-2-ylphenoxy)-[2-[(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-diphenylmethyl]phenoxy]phosphane (PubChem CID 142850693) has the molecular formula C59H70O6P2 and a molecular weight of 937.15 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylphenol);(5-methyl-2-propan-2-ylphenoxy)-[2-[(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-diphenylmethyl]phenoxy]phosphane.
| Compound Name | bis(5-methyl-2-propan-2-ylphenol);(5-methyl-2-propan-2-ylphenoxy)-[2-[(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-diphenylmethyl]phenoxy]phosphane |
|---|---|
| PubChem CID | 142850693 |
| Molecular Formula | C59H70O6P2 |
| Molecular Weight | 937.15 g/mol |
| Exact Mass | 936.46 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylphenol);(5-methyl-2-propan-2-ylphenoxy)-[2-[(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-diphenylmethyl]phenoxy]phosphane |
| SMILES | Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)c(O)c1.Cc1ccc(C(C)C)c(OPOc2ccccc2C(OPOc2cc(C)ccc2C(C)C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H42O4P2.2C10H14O/c1-27(2)33-23-21-29(5)25-37(33)41-44-40-36-20-14-13-19-35(36)39(31-15-9-7-10-16-31,32-17-11-8-12-18-32)43-45-42-38-26-30(6)22-24-34(38)28(3)4;2*1-7(2)9-5-4-8(3)6-10(9)11/h7-28,44-45H,1-6H3;2*4-7,11H,1-3H3 |
| InChIKey | DNZMEPFFVZADEQ-UHFFFAOYSA-N |
| XLogP | 17.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.15 |
| LogP ≤ 5 | 17.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|