C13H14S — CID 142853618
5-methyl-2-[(E)-2-phenylethenyl]-2,3-dihydrothiophene (PubChem CID 142853618) has the molecular formula C13H14S and a molecular weight of 202.32 g/mol. Its IUPAC name is 5-methyl-2-[(E)-2-phenylethenyl]-2,3-dihydrothiophene.
| Compound Name | 5-methyl-2-[(E)-2-phenylethenyl]-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 142853618 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 5-methyl-2-[(E)-2-phenylethenyl]-2,3-dihydrothiophene |
| SMILES | CC1=CCC(/C=C/c2ccccc2)S1 |
| InChI | InChI=1S/C13H14S/c1-11-7-9-13(14-11)10-8-12-5-3-2-4-6-12/h2-8,10,13H,9H2,1H3/b10-8+ |
| InChIKey | MSKPWMLDUUGQAX-CSKARUKUSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |