C12H20N2 — CID 142853989
4,4a-dihydroquinazoline;ethane (PubChem CID 142853989) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4,4a-dihydroquinazoline;ethane.
| Compound Name | 4,4a-dihydroquinazoline;ethane |
|---|---|
| PubChem CID | 142853989 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4,4a-dihydroquinazoline;ethane |
| SMILES | C1=CC2=NC=NCC2C=C1.CC.CC |
| InChI | InChI=1S/C8H8N2.2C2H6/c1-2-4-8-7(3-1)5-9-6-10-8;2*1-2/h1-4,6-7H,5H2;2*1-2H3 |
| InChIKey | XHMURFIKLRPAQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |