C19H28O2 — CID 142854520
3-(3,3-dimethylbut-1-enyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol (PubChem CID 142854520) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-enyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol.
| Compound Name | 3-(3,3-dimethylbut-1-enyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 142854520 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-(3,3-dimethylbut-1-enyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(C=CC(C)(C)C)C(C)(C)O2 |
| InChI | InChI=1S/C19H28O2/c1-11-12(2)17-15(13(3)16(11)20)14(19(7,8)21-17)9-10-18(4,5)6/h9-10,14,20H,1-8H3 |
| InChIKey | LPUXHQYVMUKUAJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|