C14H19BrO2 — CID 10040370
(3R)-3-(bromomethyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol (PubChem CID 10040370) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is (3R)-3-(bromomethyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol.
| Compound Name | (3R)-3-(bromomethyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 10040370 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (3R)-3-(bromomethyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)[C@@H](CBr)C(C)(C)O2 |
| InChI | InChI=1S/C14H19BrO2/c1-7-8(2)13-11(9(3)12(7)16)10(6-15)14(4,5)17-13/h10,16H,6H2,1-5H3/t10-/m1/s1 |
| InChIKey | WXDQCRXNEMLYLS-SNVBAGLBSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|