C20H27ClN2O3 — CID 142855801
ethyl 2-[2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridin-3-yl]acetate (PubChem CID 142855801) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is ethyl 2-[2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridin-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridin-3-yl]acetate |
|---|---|
| PubChem CID | 142855801 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 2-[2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5,6-dimethyl-1,4-dihydropyridin-3-yl]acetate |
| SMILES | CCOC(=O)CC1=C(COCCN)NC(C)=C(C)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H27ClN2O3/c1-4-26-19(24)11-16-18(12-25-10-9-22)23-14(3)13(2)20(16)15-7-5-6-8-17(15)21/h5-8,20,23H,4,9-12,22H2,1-3H3 |
| InChIKey | FRLIVWUGJYJYJJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|