C8H15N3S — CID 142857318
N-butyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 142857318) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is N-butyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-butyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 142857318 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-butyl-N,5-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCN(C)c1nnc(C)s1 |
| InChI | InChI=1S/C8H15N3S/c1-4-5-6-11(3)8-10-9-7(2)12-8/h4-6H2,1-3H3 |
| InChIKey | BMTRVJHIXUEZHH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |