About N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride
N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride (PubChem CID 3047401) has the molecular formula C5H10ClN3S
and a molecular weight of 179.68 g/mol. Its IUPAC name is N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride.
Analyze N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The IUPAC name of N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride (CID 3047401) is N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride.
What is the SMILES notation for N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The canonical SMILES for N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride is Cc1nnc(N(C)C)s1.Cl.
What is the InChIKey of N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride?
The InChIKey is LYGTYHLGPUCTIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.ClH/c1-4-6-7-5(9-4)8(2)3;/h1-3H3;1H.
What are the key properties of N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride?
N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride has a molecular weight of 179.68 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,5-trimethyl-1,3,4-thiadiazol-2-amine;hydrochloride is sourced from PubChem (CID 3047401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).