C9H14FN3O3 — CID 142858483
4-amino-5-fluoro-1-[1-(2-hydroxyethoxy)propyl]pyrimidin-2-one (PubChem CID 142858483) has the molecular formula C9H14FN3O3 and a molecular weight of 231.23 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-[1-(2-hydroxyethoxy)propyl]pyrimidin-2-one.
| Compound Name | 4-amino-5-fluoro-1-[1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 142858483 |
| Molecular Formula | C9H14FN3O3 |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-amino-5-fluoro-1-[1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
| SMILES | CCC(OCCO)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C9H14FN3O3/c1-2-7(16-4-3-14)13-5-6(10)8(11)12-9(13)15/h5,7,14H,2-4H2,1H3,(H2,11,12,15) |
| InChIKey | PSEYYSNFCNXVNF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |