C28H41NO5S2 — CID 142858909
(3S,7S,10R,11S,12S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxatricyclo[14.1.1.01,16]octadecane-5,9-dione (PubChem CID 142858909) has the molecular formula C28H41NO5S2 and a molecular weight of 535.77 g/mol. Its IUPAC name is (3S,7S,10R,11S,12S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxatricyclo[14.1.1.01,16]octadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxatricyclo[14.1.1.01,16]octadecane-5,9-dione |
|---|---|
| PubChem CID | 142858909 |
| Molecular Formula | C28H41NO5S2 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (3S,7S,10R,11S,12S)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4-oxatricyclo[14.1.1.01,16]octadecane-5,9-dione |
| SMILES | CSc1nc(/C=C(\C)[C@@H]2CC34CC3(CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)C4)cs1 |
| InChI | InChI=1S/C28H41NO5S2/c1-16-8-7-9-27-14-28(27,15-27)12-20(17(2)10-19-13-36-25(29-19)35-6)34-22(31)11-21(30)26(4,5)24(33)18(3)23(16)32/h10,13,16,18,20-21,23,30,32H,7-9,11-12,14-15H2,1-6H3/b17-10+/t16-,18+,20-,21-,23-,27?,28?/m0/s1 |
| InChIKey | QKSLPACSBOEVBK-QNZUPMKYSA-N |
| XLogP | 5.51 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |