C26H39NO6S2 — CID 143803118
(1R,2S,13R,15R)-2,14-dihydroxy-1,9,9,15-tetramethyl-6-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,8-dioxabicyclo[11.3.1]heptadecane-4,16-dione (PubChem CID 143803118) has the molecular formula C26H39NO6S2 and a molecular weight of 525.73 g/mol. Its IUPAC name is (1R,2S,13R,15R)-2,14-dihydroxy-1,9,9,15-tetramethyl-6-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,8-dioxabicyclo[11.3.1]heptadecane-4,16-dione.
| Compound Name | (1R,2S,13R,15R)-2,14-dihydroxy-1,9,9,15-tetramethyl-6-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,8-dioxabicyclo[11.3.1]heptadecane-4,16-dione |
|---|---|
| PubChem CID | 143803118 |
| Molecular Formula | C26H39NO6S2 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (1R,2S,13R,15R)-2,14-dihydroxy-1,9,9,15-tetramethyl-6-[(E)-1-(2-methylsulfanyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,8-dioxabicyclo[11.3.1]heptadecane-4,16-dione |
| SMILES | CSc1nc(/C=C(\C)C2COC(C)(C)CCC[C@@H]3C[C@@](C)(C(=O)[C@H](C)C3O)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C26H39NO6S2/c1-15(10-18-14-35-24(27-18)34-6)19-13-32-25(3,4)9-7-8-17-12-26(5,20(28)11-21(29)33-19)23(31)16(2)22(17)30/h10,14,16-17,19-20,22,28,30H,7-9,11-13H2,1-6H3/b15-10+/t16-,17-,19?,20+,22?,26-/m1/s1 |
| InChIKey | YYCQQBJDMFMSBF-YAROADAJSA-N |
| XLogP | 4.50 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |