C15H13NO2 — CID 142861766
1-(4-hydroxyphenyl)-3,5-dihydrocyclohepta[b]pyrrol-2-one (PubChem CID 142861766) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3,5-dihydrocyclohepta[b]pyrrol-2-one.
| Compound Name | 1-(4-hydroxyphenyl)-3,5-dihydrocyclohepta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 142861766 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3,5-dihydrocyclohepta[b]pyrrol-2-one |
| SMILES | O=C1CC2=CCC=CC=C2N1c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13NO2/c17-13-8-6-12(7-9-13)16-14-5-3-1-2-4-11(14)10-15(16)18/h1,3-9,17H,2,10H2 |
| InChIKey | FMWRNEDNTUXLFV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |