C23H32N6 — CID 142861847
2-(4-benzylpiperazin-1-yl)-4-N,4-N-dimethyl-6-N-(3-methylpenta-2,4-dien-2-yl)pyrimidine-4,6-diamine (PubChem CID 142861847) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-4-N,4-N-dimethyl-6-N-(3-methylpenta-2,4-dien-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-4-N,4-N-dimethyl-6-N-(3-methylpenta-2,4-dien-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 142861847 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-4-N,4-N-dimethyl-6-N-(3-methylpenta-2,4-dien-2-yl)pyrimidine-4,6-diamine |
| SMILES | C=CC(C)=C(C)Nc1cc(N(C)C)nc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H32N6/c1-6-18(2)19(3)24-21-16-22(27(4)5)26-23(25-21)29-14-12-28(13-15-29)17-20-10-8-7-9-11-20/h6-11,16H,1,12-15,17H2,2-5H3,(H,24,25,26) |
| InChIKey | NSWNOEOUXTWVBD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|