C35H35FN4O5S — CID 142862136
benzyl N-ethylcarbamate;N-[4-[2-(3-fluorophenyl)imino-4-oxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide (PubChem CID 142862136) has the molecular formula C35H35FN4O5S and a molecular weight of 642.75 g/mol. Its IUPAC name is benzyl N-ethylcarbamate;N-[4-[2-(3-fluorophenyl)imino-4-oxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide.
| Compound Name | benzyl N-ethylcarbamate;N-[4-[2-(3-fluorophenyl)imino-4-oxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide |
|---|---|
| PubChem CID | 142862136 |
| Molecular Formula | C35H35FN4O5S |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | benzyl N-ethylcarbamate;N-[4-[2-(3-fluorophenyl)imino-4-oxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-yl]cyclohepta-1,3,5-trien-1-yl]formamide |
| SMILES | CCNC(=O)OCc1ccccc1.O=CNC1=CC=C(C2S/C(=N\c3cccc(F)c3)N(CCOc3ccccc3)C2=O)C=CC1 |
| InChI | InChI=1S/C25H22FN3O3S.C10H13NO2/c26-19-7-5-9-21(16-19)28-25-29(14-15-32-22-10-2-1-3-11-22)24(31)23(33-25)18-6-4-8-20(13-12-18)27-17-30;1-2-11-10(12)13-8-9-6-4-3-5-7-9/h1-7,9-13,16-17,23H,8,14-15H2,(H,27,30);3-7H,2,8H2,1H3,(H,11,12)/b28-25-; |
| InChIKey | KJPUEAUOISBSRN-WLNXZIBISA-N |
| XLogP | 6.29 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|