C12H19NO — CID 142862574
4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]piperidin-4-ol (PubChem CID 142862574) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]piperidin-4-ol.
| Compound Name | 4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 142862574 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]piperidin-4-ol |
| SMILES | C/C=C\C=C/C=C/C1(O)CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-6-7-12(14)8-10-13-11-9-12/h2-7,13-14H,8-11H2,1H3/b3-2-,5-4-,7-6+ |
| InChIKey | PYTKKPKLRUMMMB-MUVPYGFYSA-N |
| XLogP | 1.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|