About 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol
4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol (PubChem CID 90418895) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol |
| PubChem CID | 90418895 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol |
| SMILES | OC1(/C=C/C(F)F)CCNCC1 |
| InChI | InChI=1S/C8H13F2NO/c9-7(10)1-2-8(12)3-5-11-6-4-8/h1-2,7,11-12H,3-6H2/b2-1+ |
| InChIKey | KCMBNIPUINOLPW-OWOJBTEDSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol?
The IUPAC name of 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol (CID 90418895) is 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol.
What is the SMILES notation for 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol?
The canonical SMILES for 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol is OC1(/C=C/C(F)F)CCNCC1.
What is the InChIKey of 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol?
The InChIKey is KCMBNIPUINOLPW-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H13F2NO/c9-7(10)1-2-8(12)3-5-11-6-4-8/h1-2,7,11-12H,3-6H2/b2-1+.
What are the key properties of 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol?
4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol has a molecular weight of 177.19 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol is sourced from PubChem (CID 90418895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).