C8H13F2NO — CID 90418895
4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol (PubChem CID 90418895) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol.
| Compound Name | 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 90418895 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-[(E)-3,3-difluoroprop-1-enyl]piperidin-4-ol |
| SMILES | OC1(/C=C/C(F)F)CCNCC1 |
| InChI | InChI=1S/C8H13F2NO/c9-7(10)1-2-8(12)3-5-11-6-4-8/h1-2,7,11-12H,3-6H2/b2-1+ |
| InChIKey | KCMBNIPUINOLPW-OWOJBTEDSA-N |
| XLogP | 0.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|