2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid

C11H21NO2 — CID 142863008

IUPAC2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid
SMILESCCCC[C@@H]1CC[C@]1(CN)CC(=O)O
InChIInChI=1S/C11H21NO2/c1-2-3-4-9-5-6-11(9,8-12)7-10(13)14/h9H,2-8,12H2,1H3,(H,13,14)/t9-,11-/m1/s1
InChIKeyGTXHZOXHQHEERQ-MWLCHTKSSA-N
MW199.29 g/mol
LogP2.01
Rot. Bonds6

About 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid

2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid (PubChem CID 142863008) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid.

Molecular Properties

Compound Name2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid
PubChem CID142863008
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Name2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid
SMILESCCCC[C@@H]1CC[C@]1(CN)CC(=O)O
InChIInChI=1S/C11H21NO2/c1-2-3-4-9-5-6-11(9,8-12)7-10(13)14/h9H,2-8,12H2,1H3,(H,13,14)/t9-,11-/m1/s1
InChIKeyGTXHZOXHQHEERQ-MWLCHTKSSA-N
XLogP2.01
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 52.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid?
The IUPAC name of 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid (CID 142863008) is 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid.
What is the SMILES notation for 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid?
The canonical SMILES for 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid is CCCC[C@@H]1CC[C@]1(CN)CC(=O)O.
What is the InChIKey of 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid?
The InChIKey is GTXHZOXHQHEERQ-MWLCHTKSSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-3-4-9-5-6-11(9,8-12)7-10(13)14/h9H,2-8,12H2,1H3,(H,13,14)/t9-,11-/m1/s1.
What are the key properties of 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid?
2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid has a molecular weight of 199.29 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-1-(aminomethyl)-2-butylcyclobutyl]acetic acid is sourced from PubChem (CID 142863008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).