C12H24ClNO2 — CID 142651659
2-[1-(aminomethyl)-4-propylcyclohexyl]acetic acid;hydrochloride (PubChem CID 142651659) has the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-4-propylcyclohexyl]acetic acid;hydrochloride.
| Compound Name | 2-[1-(aminomethyl)-4-propylcyclohexyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 142651659 |
| Molecular Formula | C12H24ClNO2 |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-[1-(aminomethyl)-4-propylcyclohexyl]acetic acid;hydrochloride |
| SMILES | CCCC1CCC(CN)(CC(=O)O)CC1.Cl |
| InChI | InChI=1S/C12H23NO2.ClH/c1-2-3-10-4-6-12(9-13,7-5-10)8-11(14)15;/h10H,2-9,13H2,1H3,(H,14,15);1H |
| InChIKey | CCVRKZXBOLVGEO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |