C10H20ClNO2 — CID 45260252
2-[1-(aminomethyl)-3-methylcyclohexyl]acetic acid;hydrochloride (PubChem CID 45260252) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-3-methylcyclohexyl]acetic acid;hydrochloride.
| Compound Name | 2-[1-(aminomethyl)-3-methylcyclohexyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 45260252 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[1-(aminomethyl)-3-methylcyclohexyl]acetic acid;hydrochloride |
| SMILES | CC1CCCC(CN)(CC(=O)O)C1.Cl |
| InChI | InChI=1S/C10H19NO2.ClH/c1-8-3-2-4-10(5-8,7-11)6-9(12)13;/h8H,2-7,11H2,1H3,(H,12,13);1H |
| InChIKey | WYSVJSFSGKOKQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |