C10H13NS — CID 142863076
(4E)-2-methyl-5-methylidene-4-[(Z)-pent-3-enylidene]-1,3-thiazole (PubChem CID 142863076) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is (4E)-2-methyl-5-methylidene-4-[(Z)-pent-3-enylidene]-1,3-thiazole.
| Compound Name | (4E)-2-methyl-5-methylidene-4-[(Z)-pent-3-enylidene]-1,3-thiazole |
|---|---|
| PubChem CID | 142863076 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (4E)-2-methyl-5-methylidene-4-[(Z)-pent-3-enylidene]-1,3-thiazole |
| SMILES | C=c1sc(C)n/c1=C/C/C=C\C |
| InChI | InChI=1S/C10H13NS/c1-4-5-6-7-10-8(2)12-9(3)11-10/h4-5,7H,2,6H2,1,3H3/b5-4-,10-7+ |
| InChIKey | WYLIXKWITRPCKF-DOIONKORSA-N |
| XLogP | 1.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|