C21H25NO2S — CID 142866272
S-[[6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-1H-quinolin-4-yl]methyl] ethanethioate (PubChem CID 142866272) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is S-[[6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-1H-quinolin-4-yl]methyl] ethanethioate.
| Compound Name | S-[[6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-1H-quinolin-4-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 142866272 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | S-[[6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-1H-quinolin-4-yl]methyl] ethanethioate |
| SMILES | COC1=C(c2ccc3c(c2)C(CSC(C)=O)=CC(C)(C)N3)C=CCC1 |
| InChI | InChI=1S/C21H25NO2S/c1-14(23)25-13-16-12-21(2,3)22-19-10-9-15(11-18(16)19)17-7-5-6-8-20(17)24-4/h5,7,9-12,22H,6,8,13H2,1-4H3 |
| InChIKey | UOACZHOOCLMIQZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|