C16H19ClF3N3O — CID 142866498
1-[6-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-8-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone (PubChem CID 142866498) has the molecular formula C16H19ClF3N3O and a molecular weight of 361.80 g/mol. Its IUPAC name is 1-[6-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-8-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone.
| Compound Name | 1-[6-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-8-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone |
|---|---|
| PubChem CID | 142866498 |
| Molecular Formula | C16H19ClF3N3O |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-[6-[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]-8-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone |
| SMILES | C/C=C(\C=C/CCl)C1CNc2c(C(C)=O)cnn2C(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H19ClF3N3O/c1-3-11(5-4-6-17)12-7-14(16(18,19)20)23-15(21-8-12)13(9-22-23)10(2)24/h3-5,9,12,14,21H,6-8H2,1-2H3/b5-4-,11-3+ |
| InChIKey | VRVNFBXRICWDQF-NEPXUXLISA-N |
| XLogP | 4.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|