C16H16F3N3O — CID 142866615
1-[5-cyclohepta-1,3,5-trien-1-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone (PubChem CID 142866615) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 1-[5-cyclohepta-1,3,5-trien-1-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone.
| Compound Name | 1-[5-cyclohepta-1,3,5-trien-1-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
|---|---|
| PubChem CID | 142866615 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-[5-cyclohepta-1,3,5-trien-1-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
| SMILES | CC(=O)c1cnn2c1NC(C1=CC=CC=CC1)CC2C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O/c1-10(23)12-9-20-22-14(16(17,18)19)8-13(21-15(12)22)11-6-4-2-3-5-7-11/h2-6,9,13-14,21H,7-8H2,1H3 |
| InChIKey | RAJKNKILASMRLD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |