C20H26F3N3O2 — CID 142866517
ethyl 5-[(3E,6Z)-7-methylnona-3,6,8-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 142866517) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is ethyl 5-[(3E,6Z)-7-methylnona-3,6,8-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[(3E,6Z)-7-methylnona-3,6,8-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 142866517 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 5-[(3E,6Z)-7-methylnona-3,6,8-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | C=C/C(C)=C\C/C(=C\CC)C1CC(C(F)(F)F)n2ncc(C(=O)OCC)c2N1 |
| InChI | InChI=1S/C20H26F3N3O2/c1-5-8-14(10-9-13(4)6-2)16-11-17(20(21,22)23)26-18(25-16)15(12-24-26)19(27)28-7-3/h6,8-9,12,16-17,25H,2,5,7,10-11H2,1,3-4H3/b13-9-,14-8+ |
| InChIKey | OKMWFXWSVJSSRJ-SUUJTOJZSA-N |
| XLogP | 5.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|