C16H21F3N4 — CID 142866690
ethene;1-[5-[(3E)-penta-1,3-dien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenamine (PubChem CID 142866690) has the molecular formula C16H21F3N4 and a molecular weight of 326.37 g/mol. Its IUPAC name is ethene;1-[5-[(3E)-penta-1,3-dien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenamine.
| Compound Name | ethene;1-[5-[(3E)-penta-1,3-dien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenamine |
|---|---|
| PubChem CID | 142866690 |
| Molecular Formula | C16H21F3N4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethene;1-[5-[(3E)-penta-1,3-dien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenamine |
| SMILES | C=C.C=C/C(=C\C)C1CC(C(F)(F)F)n2ncc(C(=C)N)c2N1 |
| InChI | InChI=1S/C14H17F3N4.C2H4/c1-4-9(5-2)11-6-12(14(15,16)17)21-13(20-11)10(7-19-21)8(3)18;1-2/h4-5,7,11-12,20H,1,3,6,18H2,2H3;1-2H2/b9-5+; |
| InChIKey | DOJCRVMKLLFLPG-SZKNIZGXSA-N |
| XLogP | 4.03 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|