C22H35F3N4O — CID 142866602
5-[(E)-but-1-enyl]-3-(1-ethoxyethenyl)-7-(1,1,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine;ethane;N-ethenylethanimine (PubChem CID 142866602) has the molecular formula C22H35F3N4O and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-3-(1-ethoxyethenyl)-7-(1,1,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine;ethane;N-ethenylethanimine.
| Compound Name | 5-[(E)-but-1-enyl]-3-(1-ethoxyethenyl)-7-(1,1,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine;ethane;N-ethenylethanimine |
|---|---|
| PubChem CID | 142866602 |
| Molecular Formula | C22H35F3N4O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 5-[(E)-but-1-enyl]-3-(1-ethoxyethenyl)-7-(1,1,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine;ethane;N-ethenylethanimine |
| SMILES | C=C(OCC)c1cnn2c1NC(/C=C/CC)CC2C(F)(F)CF.C=C/N=C/C.CC |
| InChI | InChI=1S/C16H22F3N3O.C4H7N.C2H6/c1-4-6-7-12-8-14(16(18,19)10-17)22-15(21-12)13(9-20-22)11(3)23-5-2;1-3-5-4-2;1-2/h6-7,9,12,14,21H,3-5,8,10H2,1-2H3;3-4H,1H2,2H3;1-2H3/b7-6+;5-4+; |
| InChIKey | KWJHJQASXVIAPM-AXZSHOHOSA-N |
| XLogP | 6.43 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|