C15H15F3N4O — CID 142866598
1-[5-(2H-azepin-6-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol (PubChem CID 142866598) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-[5-(2H-azepin-6-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol.
| Compound Name | 1-[5-(2H-azepin-6-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol |
|---|---|
| PubChem CID | 142866598 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[5-(2H-azepin-6-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol |
| SMILES | C=C(O)c1cnn2c1NC(C1=CC=CCN=C1)CC2C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O/c1-9(23)11-8-20-22-13(15(16,17)18)6-12(21-14(11)22)10-4-2-3-5-19-7-10/h2-4,7-8,12-13,21,23H,1,5-6H2 |
| InChIKey | IPQFBTPXYNWULR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|