C18H25N3O — CID 142866773
1-(5-cyclohexa-2,4-dien-1-yl-7,7-diethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl)ethenol (PubChem CID 142866773) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(5-cyclohexa-2,4-dien-1-yl-7,7-diethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl)ethenol.
| Compound Name | 1-(5-cyclohexa-2,4-dien-1-yl-7,7-diethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl)ethenol |
|---|---|
| PubChem CID | 142866773 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-(5-cyclohexa-2,4-dien-1-yl-7,7-diethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl)ethenol |
| SMILES | C=C(O)c1cnn2c1NC(C1C=CC=CC1)CC2(CC)CC |
| InChI | InChI=1S/C18H25N3O/c1-4-18(5-2)11-16(14-9-7-6-8-10-14)20-17-15(13(3)22)12-19-21(17)18/h6-9,12,14,16,20,22H,3-5,10-11H2,1-2H3 |
| InChIKey | VXIVXVCNUVMQHA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|