C19H24F3N3O2 — CID 142866588
ethane;1-[5-(5-methoxycyclohepta-1,3,5-trien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol (PubChem CID 142866588) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is ethane;1-[5-(5-methoxycyclohepta-1,3,5-trien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol.
| Compound Name | ethane;1-[5-(5-methoxycyclohepta-1,3,5-trien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol |
|---|---|
| PubChem CID | 142866588 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethane;1-[5-(5-methoxycyclohepta-1,3,5-trien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethenol |
| SMILES | C=C(O)c1cnn2c1NC(C1=CC=CC(OC)=CC1)CC2C(F)(F)F.CC |
| InChI | InChI=1S/C17H18F3N3O2.C2H6/c1-10(24)13-9-21-23-15(17(18,19)20)8-14(22-16(13)23)11-4-3-5-12(25-2)7-6-11;1-2/h3-5,7,9,14-15,22,24H,1,6,8H2,2H3;1-2H3 |
| InChIKey | PUUKADWHEZVBJI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|