C45H65N3O7 — CID 142867135
benzyl 3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzoate;3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzamide (PubChem CID 142867135) has the molecular formula C45H65N3O7 and a molecular weight of 760.03 g/mol. Its IUPAC name is benzyl 3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzoate;3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzamide.
| Compound Name | benzyl 3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzoate;3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 142867135 |
| Molecular Formula | C45H65N3O7 |
| Molecular Weight | 760.03 g/mol |
| Exact Mass | 759.48 |
| IUPAC Name | benzyl 3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzoate;3-(2-ethylpentanoylamino)-5-(3-methylbutoxy)benzamide |
| SMILES | CCCC(CC)C(=O)Nc1cc(OCCC(C)C)cc(C(=O)OCc2ccccc2)c1.CCCC(CC)C(=O)Nc1cc(OCCC(C)C)cc(C(N)=O)c1 |
| InChI | InChI=1S/C26H35NO4.C19H30N2O3/c1-5-10-21(6-2)25(28)27-23-15-22(16-24(17-23)30-14-13-19(3)4)26(29)31-18-20-11-8-7-9-12-20;1-5-7-14(6-2)19(23)21-16-10-15(18(20)22)11-17(12-16)24-9-8-13(3)4/h7-9,11-12,15-17,19,21H,5-6,10,13-14,18H2,1-4H3,(H,27,28);10-14H,5-9H2,1-4H3,(H2,20,22)(H,21,23) |
| InChIKey | ZERDVAYFQBHAFO-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.03 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |