C16H24N2O5 — CID 142867245
tert-butyl N-[(1S)-1-cyclopentyl-2-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate (PubChem CID 142867245) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cyclopentyl-2-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-cyclopentyl-2-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 142867245 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-cyclopentyl-2-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)[C@H]1CC(=O)NC1=O)C1CCCC1 |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(22)18-12(9-6-4-5-7-9)13(20)10-8-11(19)17-14(10)21/h9-10,12H,4-8H2,1-3H3,(H,18,22)(H,17,19,21)/t10-,12+/m1/s1 |
| InChIKey | ZQJDMYVJVNLNGU-PWSUYJOCSA-N |
| XLogP | 1.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|