C28H44N2O5 — CID 158464133
tert-butyl N-[(1S)-1-cyclohexyl-2-cyclopropyl-2-oxoethyl]carbamate;(2S)-2-cyclohexyl-1-cyclopropyl-2-isocyanatoethanone (PubChem CID 158464133) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cyclohexyl-2-cyclopropyl-2-oxoethyl]carbamate;(2S)-2-cyclohexyl-1-cyclopropyl-2-isocyanatoethanone.
| Compound Name | tert-butyl N-[(1S)-1-cyclohexyl-2-cyclopropyl-2-oxoethyl]carbamate;(2S)-2-cyclohexyl-1-cyclopropyl-2-isocyanatoethanone |
|---|---|
| PubChem CID | 158464133 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | tert-butyl N-[(1S)-1-cyclohexyl-2-cyclopropyl-2-oxoethyl]carbamate;(2S)-2-cyclohexyl-1-cyclopropyl-2-isocyanatoethanone |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)C1CC1)C1CCCCC1.O=C=N[C@H](C(=O)C1CC1)C1CCCCC1 |
| InChI | InChI=1S/C16H27NO3.C12H17NO2/c1-16(2,3)20-15(19)17-13(14(18)12-9-10-12)11-7-5-4-6-8-11;14-8-13-11(12(15)10-6-7-10)9-4-2-1-3-5-9/h11-13H,4-10H2,1-3H3,(H,17,19);9-11H,1-7H2/t13-;11-/m00/s1 |
| InChIKey | HFNSUKUUQJUMRB-DMGMNCNXSA-N |
| XLogP | 5.69 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|