C12H17NO3 — CID 165471005
tert-butyl N-(1-cyclopropyl-2-oxobut-3-ynyl)carbamate (PubChem CID 165471005) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is tert-butyl N-(1-cyclopropyl-2-oxobut-3-ynyl)carbamate.
| Compound Name | tert-butyl N-(1-cyclopropyl-2-oxobut-3-ynyl)carbamate |
|---|---|
| PubChem CID | 165471005 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | tert-butyl N-(1-cyclopropyl-2-oxobut-3-ynyl)carbamate |
| SMILES | C#CC(=O)C(NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C12H17NO3/c1-5-9(14)10(8-6-7-8)13-11(15)16-12(2,3)4/h1,8,10H,6-7H2,2-4H3,(H,13,15) |
| InChIKey | BNRBWFOJGCUQOS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|