C24H31FN4O5 — CID 142867269
N-(3-amino-3-oxo-1-phenylpropyl)-6-fluoropyridine-3-carboxamide;3-hydroxy-N,6-dimethyl-4-oxoheptanamide (PubChem CID 142867269) has the molecular formula C24H31FN4O5 and a molecular weight of 474.53 g/mol. Its IUPAC name is N-(3-amino-3-oxo-1-phenylpropyl)-6-fluoropyridine-3-carboxamide;3-hydroxy-N,6-dimethyl-4-oxoheptanamide.
| Compound Name | N-(3-amino-3-oxo-1-phenylpropyl)-6-fluoropyridine-3-carboxamide;3-hydroxy-N,6-dimethyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 142867269 |
| Molecular Formula | C24H31FN4O5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-(3-amino-3-oxo-1-phenylpropyl)-6-fluoropyridine-3-carboxamide;3-hydroxy-N,6-dimethyl-4-oxoheptanamide |
| SMILES | CNC(=O)CC(O)C(=O)CC(C)C.NC(=O)CC(NC(=O)c1ccc(F)nc1)c1ccccc1 |
| InChI | InChI=1S/C15H14FN3O2.C9H17NO3/c16-13-7-6-11(9-18-13)15(21)19-12(8-14(17)20)10-4-2-1-3-5-10;1-6(2)4-7(11)8(12)5-9(13)10-3/h1-7,9,12H,8H2,(H2,17,20)(H,19,21);6,8,12H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | JRUIIXICUZEGBM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|