C10H17ClN2O2 — CID 142867300
2-chloro-N-[(E)-C-[(E)-3,3-dimethylbut-1-enyl]-N-methoxycarbonimidoyl]acetamide (PubChem CID 142867300) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-chloro-N-[(E)-C-[(E)-3,3-dimethylbut-1-enyl]-N-methoxycarbonimidoyl]acetamide.
| Compound Name | 2-chloro-N-[(E)-C-[(E)-3,3-dimethylbut-1-enyl]-N-methoxycarbonimidoyl]acetamide |
|---|---|
| PubChem CID | 142867300 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-chloro-N-[(E)-C-[(E)-3,3-dimethylbut-1-enyl]-N-methoxycarbonimidoyl]acetamide |
| SMILES | CO/N=C(\C=C\C(C)(C)C)NC(=O)CCl |
| InChI | InChI=1S/C10H17ClN2O2/c1-10(2,3)6-5-8(13-15-4)12-9(14)7-11/h5-6H,7H2,1-4H3,(H,12,13,14)/b6-5+ |
| InChIKey | IAXLWRJTWYJVAP-AATRIKPKSA-N |
| XLogP | 1.90 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|