C20H28N2O2 — CID 142869426
9-(2-imidazol-1-yl-1-phenylethoxy)nonan-2-one (PubChem CID 142869426) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 9-(2-imidazol-1-yl-1-phenylethoxy)nonan-2-one.
| Compound Name | 9-(2-imidazol-1-yl-1-phenylethoxy)nonan-2-one |
|---|---|
| PubChem CID | 142869426 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 9-(2-imidazol-1-yl-1-phenylethoxy)nonan-2-one |
| SMILES | CC(=O)CCCCCCCOC(Cn1ccnc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O2/c1-18(23)10-6-3-2-4-9-15-24-20(16-22-14-13-21-17-22)19-11-7-5-8-12-19/h5,7-8,11-14,17,20H,2-4,6,9-10,15-16H2,1H3 |
| InChIKey | UWZJJRHNGAJTMY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|