C26H40N2O3 — CID 142869410
ethyl 11-[1-(2,4-dimethylphenyl)-2-imidazol-1-ylethoxy]undecanoate (PubChem CID 142869410) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is ethyl 11-[1-(2,4-dimethylphenyl)-2-imidazol-1-ylethoxy]undecanoate.
| Compound Name | ethyl 11-[1-(2,4-dimethylphenyl)-2-imidazol-1-ylethoxy]undecanoate |
|---|---|
| PubChem CID | 142869410 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | ethyl 11-[1-(2,4-dimethylphenyl)-2-imidazol-1-ylethoxy]undecanoate |
| SMILES | CCOC(=O)CCCCCCCCCCOC(Cn1ccnc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C26H40N2O3/c1-4-30-26(29)13-11-9-7-5-6-8-10-12-18-31-25(20-28-17-16-27-21-28)24-15-14-22(2)19-23(24)3/h14-17,19,21,25H,4-13,18,20H2,1-3H3 |
| InChIKey | FGZBFVWDLJVCKR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|