C30H36N6 — CID 142870818
prop-1-ene;2-[3-[3-[7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]hexyl]phenyl]propanenitrile (PubChem CID 142870818) has the molecular formula C30H36N6 and a molecular weight of 480.66 g/mol. Its IUPAC name is prop-1-ene;2-[3-[3-[7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]hexyl]phenyl]propanenitrile.
| Compound Name | prop-1-ene;2-[3-[3-[7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]hexyl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 142870818 |
| Molecular Formula | C30H36N6 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | prop-1-ene;2-[3-[3-[7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyrimidin-5-yl]hexyl]phenyl]propanenitrile |
| SMILES | C=CC.CCCC(CCc1cccc(C(C)C#N)c1)c1cc(NCc2cccnc2)n2nccc2n1 |
| InChI | InChI=1S/C27H30N6.C3H6/c1-3-6-23(11-10-21-7-4-9-24(15-21)20(2)17-28)25-16-27(33-26(32-25)12-14-31-33)30-19-22-8-5-13-29-18-22;1-3-2/h4-5,7-9,12-16,18,20,23,30H,3,6,10-11,19H2,1-2H3;3H,1H2,2H3 |
| InChIKey | HVEHDYGPOOLARA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|