C20H18BrN5O2S — CID 142871044
N-[2-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-thiophen-2-ylacetamide (PubChem CID 142871044) has the molecular formula C20H18BrN5O2S and a molecular weight of 472.37 g/mol. Its IUPAC name is N-[2-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 142871044 |
| Molecular Formula | C20H18BrN5O2S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | N-[2-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCNc1cc(-c2ccccc2O)nc2c(Br)cnn12 |
| InChI | InChI=1S/C20H18BrN5O2S/c21-15-12-24-26-18(22-7-8-23-19(28)10-13-4-3-9-29-13)11-16(25-20(15)26)14-5-1-2-6-17(14)27/h1-6,9,11-12,22,27H,7-8,10H2,(H,23,28) |
| InChIKey | LXSFFFRVNZARHJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|