C18H17BrN6O2S2 — CID 89365737
N-[2-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 89365737) has the molecular formula C18H17BrN6O2S2 and a molecular weight of 493.41 g/mol. Its IUPAC name is N-[2-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 89365737 |
| Molecular Formula | C18H17BrN6O2S2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | N-[2-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Nc1ccccc1-c1cc(NCCNS(=O)(=O)c2cccs2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C18H17BrN6O2S2/c19-13-11-22-25-16(21-7-8-23-29(26,27)17-6-3-9-28-17)10-15(24-18(13)25)12-4-1-2-5-14(12)20/h1-6,9-11,21,23H,7-8,20H2 |
| InChIKey | OFBQUKAJYXWMHY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|