About [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate
[4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate (PubChem CID 14287122) has the molecular formula C20H28O5
and a molecular weight of 348.44 g/mol. Its IUPAC name is [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate.
Molecular Properties
| Compound Name | [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate |
| PubChem CID | 14287122 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)Oc1ccc(C2OC2COC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C20H28O5/c1-5-14(4)11-19(22)24-16-8-6-15(7-9-16)20-17(25-20)12-23-18(21)10-13(2)3/h6-9,13-14,17,20H,5,10-12H2,1-4H3 |
| InChIKey | GBPPJYKZXGTQRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate?
The IUPAC name of [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate (CID 14287122) is [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate.
What is the SMILES notation for [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate?
The canonical SMILES for [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate is CCC(C)CC(=O)Oc1ccc(C2OC2COC(=O)CC(C)C)cc1.
What is the InChIKey of [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate?
The InChIKey is GBPPJYKZXGTQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O5/c1-5-14(4)11-19(22)24-16-8-6-15(7-9-16)20-17(25-20)12-23-18(21)10-13(2)3/h6-9,13-14,17,20H,5,10-12H2,1-4H3.
What are the key properties of [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate?
[4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate has a molecular weight of 348.44 g/mol, XLogP of 4.06, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(3-methylbutanoyloxymethyl)oxiran-2-yl]phenyl] 3-methylpentanoate is sourced from PubChem (CID 14287122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).