C24H20BrFN6O — CID 142871434
1-[2-[[3-bromo-5-[2-(cyclopropen-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-3-(2-fluorophenyl)urea (PubChem CID 142871434) has the molecular formula C24H20BrFN6O and a molecular weight of 507.37 g/mol. Its IUPAC name is 1-[2-[[3-bromo-5-[2-(cyclopropen-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-[[3-bromo-5-[2-(cyclopropen-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 142871434 |
| Molecular Formula | C24H20BrFN6O |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 1-[2-[[3-bromo-5-[2-(cyclopropen-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(NCCNc1cc(-c2ccccc2C2=CC2)nc2c(Br)cnn12)Nc1ccccc1F |
| InChI | InChI=1S/C24H20BrFN6O/c25-18-14-29-32-22(27-11-12-28-24(33)31-20-8-4-3-7-19(20)26)13-21(30-23(18)32)17-6-2-1-5-16(17)15-9-10-15/h1-9,13-14,27H,10-12H2,(H2,28,31,33) |
| InChIKey | HJGIHOMKEFRCJL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|