C16H20N2OS — CID 142872045
N-(4-cyclohexylphenyl)sulfanyl-5-methyl-1,2-oxazol-3-amine (PubChem CID 142872045) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)sulfanyl-5-methyl-1,2-oxazol-3-amine.
| Compound Name | N-(4-cyclohexylphenyl)sulfanyl-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 142872045 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(4-cyclohexylphenyl)sulfanyl-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1cc(NSc2ccc(C3CCCCC3)cc2)no1 |
| InChI | InChI=1S/C16H20N2OS/c1-12-11-16(17-19-12)18-20-15-9-7-14(8-10-15)13-5-3-2-4-6-13/h7-11,13H,2-6H2,1H3,(H,17,18) |
| InChIKey | HKVQKROCWPCWFK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|