C16H12F2N2OS — CID 142871876
N-[4-(3,4-difluorophenyl)phenyl]sulfanyl-5-methyl-1,2-oxazol-3-amine (PubChem CID 142871876) has the molecular formula C16H12F2N2OS and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)phenyl]sulfanyl-5-methyl-1,2-oxazol-3-amine.
| Compound Name | N-[4-(3,4-difluorophenyl)phenyl]sulfanyl-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 142871876 |
| Molecular Formula | C16H12F2N2OS |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)phenyl]sulfanyl-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1cc(NSc2ccc(-c3ccc(F)c(F)c3)cc2)no1 |
| InChI | InChI=1S/C16H12F2N2OS/c1-10-8-16(19-21-10)20-22-13-5-2-11(3-6-13)12-4-7-14(17)15(18)9-12/h2-9H,1H3,(H,19,20) |
| InChIKey | GQKUIOAQZQADRP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|