C33H49F2N3O5S — CID 142872246
(2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]-3-(2-heptan-4-yl-1,3,2-dioxathietan-2-yl)-2-(propanoylamino)propanamide (PubChem CID 142872246) has the molecular formula C33H49F2N3O5S and a molecular weight of 637.83 g/mol. Its IUPAC name is (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]-3-(2-heptan-4-yl-1,3,2-dioxathietan-2-yl)-2-(propanoylamino)propanamide.
| Compound Name | (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]-3-(2-heptan-4-yl-1,3,2-dioxathietan-2-yl)-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 142872246 |
| Molecular Formula | C33H49F2N3O5S |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | (2S)-N-[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-2-hydroxybutyl]-N-[(3-ethylphenyl)methyl]-3-(2-heptan-4-yl-1,3,2-dioxathietan-2-yl)-2-(propanoylamino)propanamide |
| SMILES | CCCC(CCC)S1(C[C@@H](NC(=O)CC)C(=O)N(Cc2cccc(CC)c2)C[C@@H](O)[C@@H](N)Cc2cc(F)cc(F)c2)OCO1 |
| InChI | InChI=1S/C33H49F2N3O5S/c1-5-10-28(11-6-2)44(42-22-43-44)21-30(37-32(40)8-4)33(41)38(19-24-13-9-12-23(7-3)14-24)20-31(39)29(36)17-25-15-26(34)18-27(35)16-25/h9,12-16,18,28-31,39H,5-8,10-11,17,19-22,36H2,1-4H3,(H,37,40)/t29-,30+,31+/m0/s1 |
| InChIKey | JJONPDRHSXZJGE-OJDZSJEKSA-N |
| XLogP | 5.29 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |